| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:46:13 UTC |
|---|
| Update Date | 2025-03-21 18:00:49 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00029483 |
|---|
| Frequency | 126.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H14O11S2 |
|---|
| Molecular Mass | 433.9978 |
|---|
| SMILES | O=S(O)Oc1cc(O)c2c(c1)OC(c1ccc(O)c(O)c1)C(OS(=O)(=O)O)C2 |
|---|
| InChI Key | AAEABXUAOFGESI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | flavonoids |
|---|
| Subclass | flavans |
|---|
| Direct Parent | catechins |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-benzopyrans1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoids3'-hydroxyflavonoids3-sulfated flavonoids4'-hydroxyflavonoids5-hydroxyflavonoidsalkyl aryl ethersalkyl sulfatesbenzene and substituted derivativeshydrocarbon derivativesorganic oxidesoxacyclic compoundssulfuric acid monoesters |
|---|
| Substituents | monocyclic benzene moietysulfuric acid monoesterether1-benzopyran1-hydroxy-2-unsubstituted benzenoidalkyl aryl etherorganic oxidearomatic heteropolycyclic compoundalkyl sulfatechromanecatechinorganoheterocyclic compoundbenzopyranorganic sulfuric acid or derivatives3-sulfated flavonoid5-hydroxyflavonoid1-hydroxy-4-unsubstituted benzenoid3'-hydroxyflavonoidoxacycleorganic oxygen compound4'-hydroxyflavonoidsulfate-esterphenolhydrocarbon derivativebenzenoidsulfuric acid esterorganooxygen compound |
|---|