Record Information |
---|
HMDB Status | detected |
---|
Creation Date | 2024-02-20 23:46:21 UTC |
---|
Update Date | 2025-03-21 18:00:52 UTC |
---|
HMDB ID | HMDB0257193 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00029773 |
---|
Name | Rhamnocitrin |
---|
Frequency | 125.4 |
---|
Structure | |
---|
Chemical Formula | C16H12O6 |
---|
Molecular Mass | 300.0634 |
---|
SMILES | COc1cc(O)c2c(=O)c(O)c(-c3ccc(O)cc3)oc2c1 |
---|
InChI Key | MQSZRBPYXNEFHF-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | phenylpropanoids and polyketides |
---|
Class | flavonoids |
---|
Subclass | flavones |
---|
Direct Parent | flavonols |
---|
Geometric Descriptor | aromatic heteropolycyclic compounds |
---|
Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoids3-hydroxyflavonoids4'-hydroxyflavonoids5-hydroxyflavonoids7-o-methylated flavonoidsalkyl aryl ethersanisolesbenzene and substituted derivativeschromonesflavonoidsheteroaromatic compoundshydrocarbon derivativesorganic oxidesoxacyclic compoundspyranones and derivativesvinylogous acids |
---|
Substituents | 3-hydroxyflavonephenol ethermonocyclic benzene moiety3-hydroxyflavonoidether1-benzopyran1-hydroxy-2-unsubstituted benzenoidalkyl aryl etherorganic oxidechromonearomatic heteropolycyclic compoundpyranoneorganoheterocyclic compoundbenzopyranheteroaromatic compound5-hydroxyflavonoid1-hydroxy-4-unsubstituted benzenoidoxacyclevinylogous acidorganic oxygen compoundpyrananisole4'-hydroxyflavonoidphenolhydrocarbon derivativebenzenoid7-methoxyflavonoid-skeletonorganooxygen compound |
---|