| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:46:25 UTC |
|---|
| Update Date | 2025-03-21 18:00:53 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00029925 |
|---|
| Frequency | 124.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H8O9S |
|---|
| Molecular Mass | 279.9889 |
|---|
| SMILES | O=C(OS(=O)(=O)O)c1cc(O)c(O)c(O)c1CO |
|---|
| InChI Key | OYQUDKTXBDWLTJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenols |
|---|
| Subclass | benzenetriols and derivatives |
|---|
| Direct Parent | pyrogallols and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsaromatic alcoholsbenzoic acids and derivativesbenzoyl derivativesbenzyl alcoholshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidessulfuric acid monoesters |
|---|
| Substituents | aromatic alcoholalcoholmonocyclic benzene moietysulfuric acid monoesterorganic sulfuric acid or derivativespyrogallol derivativebenzoyl1-hydroxy-2-unsubstituted benzenoidbenzoic acid or derivativesbenzyl alcohol1-hydroxy-4-unsubstituted benzenoidcarboxylic acid derivativearomatic homomonocyclic compoundorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundhydrocarbon derivativesulfuric acid esterorganooxygen compound |
|---|