| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:46:26 UTC |
|---|
| Update Date | 2025-03-21 18:00:54 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00029963 |
|---|
| Frequency | 124.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C19H27NO2 |
|---|
| Molecular Mass | 301.2042 |
|---|
| SMILES | COc1cc2c(cc1OC)C13CCCCC1C(C2)N(C)CC3 |
|---|
| InChI Key | GTRFNPJHWFWSQR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | alkaloids and derivatives |
|---|
| Class | morphinans |
|---|
| Subclass | morphinans |
|---|
| Direct Parent | morphinans |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersanisolesazacyclic compoundsbenzazocineshydrocarbon derivativesorganopnictogen compoundsphenanthrenes and derivativespiperidinestetralinstrialkylamines |
|---|
| Substituents | tetralinphenol etherphenanthreneetherazacycletertiary aliphatic aminealkyl aryl etherorganic oxygen compoundaromatic heteropolycyclic compoundanisolebenzazocineorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundpiperidinemorphinanaminetertiary amineorganoheterocyclic compoundorganooxygen compound |
|---|
