| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:46:29 UTC |
|---|
| Update Date | 2025-03-21 18:00:55 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00030100 |
|---|
| Frequency | 123.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H8Cl2O3 |
|---|
| Molecular Mass | 281.985 |
|---|
| SMILES | O=C(O)c1ccccc1Oc1ccc(Cl)cc1Cl |
|---|
| InChI Key | IQJCZFBHCZXULX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylethers |
|---|
| Direct Parent | diphenylethers |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-carboxy-2-haloaromatic compoundsaryl chloridesbenzoic acidsbenzoyl derivativesdiarylethersdichlorobenzeneshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganochloridesphenol ethersphenoxy compounds |
|---|
| Substituents | diaryl etherphenol etherethercarboxylic acidorganochloridebenzoylcarboxylic acid derivativeorganohalogen compound1,3-dichlorobenzeneorganic oxide1-carboxy-2-haloaromatic compoundbenzoic acidaryl chloridechlorobenzenebenzoic acid or derivativesaryl halidearomatic homomonocyclic compoundmonocarboxylic acid or derivativesorganic oxygen compoundhydrocarbon derivativehalobenzenephenoxy compounddiphenyletherorganooxygen compound |
|---|
