Record Information |
---|
HMDB Status | expected |
---|
Creation Date | 2024-02-20 23:46:30 UTC |
---|
Update Date | 2025-03-21 18:00:56 UTC |
---|
HMDB ID | HMDB0029296 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00030117 |
---|
Name | p-Coumaroyl 3-hydroxytyrosine |
---|
Frequency | 123.6 |
---|
Structure | |
---|
Chemical Formula | C18H17NO6 |
---|
Molecular Mass | 343.1056 |
---|
SMILES | O=C(C=Cc1ccc(O)cc1)NC(Cc1ccc(O)c(O)c1)C(=O)O |
---|
InChI Key | UUXSHXGLOWJTDV-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic acids and derivatives |
---|
Class | carboxylic acids and derivatives |
---|
Subclass | amino acids, peptides, and analogues |
---|
Direct Parent | tyrosine and derivatives |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsalpha amino acidsamphetamines and derivativesbenzene and substituted derivativescarbonyl compoundscarboxylic acidshydrocarbon derivativeshydroxycinnamic acidsmonocarboxylic acids and derivativesn-acyl-alpha amino acidsorganic oxidesorganonitrogen compoundsorganopnictogen compoundsphenylalanine and derivativesphenylpropanoic acidssecondary carboxylic acid amides |
---|
Substituents | monocyclic benzene moietycarbonyl groupcarboxylic acid3-phenylpropanoic-acid1-hydroxy-2-unsubstituted benzenoidhydroxycinnamic acid or derivativescinnamic acid or derivativesorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundamphetamine or derivativesn-acyl-alpha amino acid or derivativestyrosine or derivativesn-acyl-alpha-amino acid1-hydroxy-4-unsubstituted benzenoidcarboxamide grouphydroxycinnamic acidaromatic homomonocyclic compoundsecondary carboxylic acid amidemonocarboxylic acid or derivativesphenylalanine or derivativesorganic oxygen compoundphenolhydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compound |
---|