| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:46:31 UTC |
|---|
| Update Date | 2025-03-21 18:00:56 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00030184 |
|---|
| Frequency | 123.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H21N |
|---|
| Molecular Mass | 239.1674 |
|---|
| SMILES | CC(C(c1ccccc1)c1ccccc1)N(C)C |
|---|
| InChI Key | XLIGWUKNUUSZMD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylmethanes |
|---|
| Direct Parent | diphenylmethanes |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | amphetamines and derivativeshydrocarbon derivativesorganopnictogen compoundsphenylpropanestrialkylamines |
|---|
| Substituents | diphenylmethanetertiary aliphatic aminephenylpropanearomatic homomonocyclic compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundamineamphetamine or derivativestertiary amine |
|---|
