| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:46:32 UTC |
|---|
| Update Date | 2025-03-21 18:00:57 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00030204 |
|---|
| Frequency | 123.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H13O9P |
|---|
| Molecular Mass | 260.0297 |
|---|
| SMILES | O=[PH](=O)(O)OCC1OC(O)C(O)C(O)C1O |
|---|
| InChI Key | FILRQECQUCCKHI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | monosaccharides |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | hemiacetalshydrocarbon derivativesorganic oxidesorganic phosphoric acids and derivativesoxacyclic compoundsoxanessecondary alcohols |
|---|
| Substituents | alcoholmonosaccharideoxacycleorganic oxidealiphatic heteromonocyclic compoundsecondary alcoholhemiacetalhydrocarbon derivativeoxaneorganic phosphoric acid derivativeorganoheterocyclic compound |
|---|
