| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:46:33 UTC |
|---|
| Update Date | 2025-03-21 18:00:58 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00030235 |
|---|
| Frequency | 123.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H10O3 |
|---|
| Molecular Mass | 214.063 |
|---|
| SMILES | O=C(Oc1ccc(O)cc1)c1ccccc1 |
|---|
| InChI Key | JFAXJRJMFOACBO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | depsides and depsidones |
|---|
| Subclass | depsides and depsidones |
|---|
| Direct Parent | depsides and depsidones |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsbenzoic acid estersbenzoyl derivativescarboxylic acid estershydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganooxygen compoundsphenol estersphenoxy compounds |
|---|
| Substituents | monocyclic benzene moietybenzoyl1-hydroxy-2-unsubstituted benzenoidbenzoic acid or derivativesbenzoate estercarboxylic acid derivativearomatic homomonocyclic compoundorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid esterphenol esterphenolhydrocarbon derivativebenzenoidphenoxy compoundorganooxygen compounddepside backbone |
|---|
