| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:46:33 UTC |
|---|
| Update Date | 2025-03-21 18:00:57 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00030263 |
|---|
| Frequency | 122.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C24H28O10 |
|---|
| Molecular Mass | 476.1682 |
|---|
| SMILES | O=C1OCC(Cc2cccc(O)c2)C1Cc1cccc(OC2OC(C(O)O)C(O)C(O)C2O)c1 |
|---|
| InChI Key | QQQUXDFYKWXDJA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lignans, neolignans and related compounds |
|---|
| Class | lignan glycosides |
|---|
| Subclass | lignan glycosides |
|---|
| Direct Parent | lignan glycosides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsacetalscarbonyl compoundscarbonyl hydratescarboxylic acid estersdibenzylbutyrolactone lignansgamma butyrolactoneshydrocarbon derivativeslignan lactonesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanesphenol ethersphenoxy compoundssecondary alcoholstetrahydrofurans |
|---|
| Substituents | phenol ethermonocyclic benzene moietycarbonyl groupcarbonyl hydratearomatic heteromonocyclic compoundlignan glycosidedibenzylbutyrolactone1-hydroxy-2-unsubstituted benzenoidmonosaccharidecarboxylic acid derivativelignan lactonelactonesaccharideorganic oxideacetal9,9p-epoxylignanoxaneorganoheterocyclic compoundalcoholtetrahydrofuran1-hydroxy-4-unsubstituted benzenoidgamma butyrolactoneoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid esterfuranoid lignansecondary alcoholphenolhydrocarbon derivativetetrahydrofuran lignanbenzenoidphenoxy compoundorganooxygen compound |
|---|