Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-20 23:46:35 UTC |
---|
Update Date | 2025-03-21 18:00:58 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00030316 |
---|
Frequency | 122.7 |
---|
Structure | |
---|
Chemical Formula | C13H11NO6S |
---|
Molecular Mass | 309.0307 |
---|
SMILES | O=C(Nc1ccc(OS(=O)(=O)O)cc1)c1ccccc1O |
---|
InChI Key | ZGAVPTBCKJFNLC-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | benzenoids |
---|
Class | benzene and substituted derivatives |
---|
Subclass | anilides |
---|
Direct Parent | benzanilides |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsbenzamidesbenzoyl derivativescarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundsphenoxy compoundsphenylsulfatessalicylamidessecondary carboxylic acid amidessulfuric acid monoestersvinylogous acids |
---|
Substituents | sulfuric acid monoesterbenzanilidebenzoyl1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativebenzamidephenylsulfateorganic oxideorganonitrogen compoundorganopnictogen compoundarylsulfateorganic sulfuric acid or derivativesbenzoic acid or derivatives1-hydroxy-4-unsubstituted benzenoidcarboxamide groupsalicylamidearomatic homomonocyclic compoundsecondary carboxylic acid amidevinylogous acidorganic oxygen compoundsalicylic acid or derivativessulfate-esterphenolhydrocarbon derivativeorganic nitrogen compoundphenoxy compoundsulfuric acid esterorganooxygen compound |
---|