| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:46:36 UTC |
|---|
| Update Date | 2025-03-21 18:00:59 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00030380 |
|---|
| Frequency | 122.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H11N4O7P |
|---|
| Molecular Mass | 306.0365 |
|---|
| SMILES | Nc1ncn(C2OC(CO)C3OP(=O)(O)OC32)c(=O)n1 |
|---|
| InChI Key | HPOAWYIWPQFOOH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | triazines |
|---|
| Subclass | aminotriazines |
|---|
| Direct Parent | aminotriazines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsdioxaphospholaneshalo-s-triazinesheteroaromatic compoundshydrocarbon derivativesorganic carbonic acids and derivativesorganic oxidesorganic phosphoric acids and derivativesorganopnictogen compoundsoxacyclic compoundsprimary alcoholsprimary aminestetrahydrofuranstriazinones |
|---|
| Substituents | amino-1,3,5-triazineorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundprimary alcoholalcoholcarbonic acid derivativeazacycletetrahydrofuranaminotriazineheteroaromatic compound1,3_dioxaphospholaneoxacycleorganic oxygen compoundhalo-s-triazinehydrocarbon derivative1,3,5-triazineprimary amineorganic nitrogen compoundorganic phosphoric acid derivativeaminetriazinoneorganooxygen compound |
|---|
