| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:46:36 UTC |
|---|
| Update Date | 2025-03-21 18:00:59 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00030382 |
|---|
| Frequency | 122.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H23NO5 |
|---|
| Molecular Mass | 321.1576 |
|---|
| SMILES | CC(=O)Nc1ccc(OC2OC(C(=O)O)C(C)C(C)C2C)cc1 |
|---|
| InChI Key | UZJIPJUTJBQKGT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | anilides |
|---|
| Direct Parent | acetanilides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalsacetamidescarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesn-acetylarylaminesorganic oxidesorganopnictogen compoundsoxacyclic compoundsoxanesphenol ethersphenoxy compoundspyran carboxylic acidssecondary carboxylic acid amides |
|---|
| Substituents | phenol ethercarbonyl groupcarboxylic acidn-acetylarylaminearomatic heteromonocyclic compoundn-arylamidecarboxylic acid derivativepyran carboxylic acidorganic oxideacetalorganonitrogen compoundorganopnictogen compoundoxaneorganoheterocyclic compoundacetamidepyran carboxylic acid or derivativesacetanilidecarboxamide groupoxacyclesecondary carboxylic acid amidemonocarboxylic acid or derivativesorganic oxygen compoundpyranhydrocarbon derivativeorganic nitrogen compoundphenoxy compoundorganooxygen compound |
|---|
