| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:46:38 UTC |
|---|
| Update Date | 2025-03-21 18:01:00 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00030436 |
|---|
| Frequency | 122.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H18O6 |
|---|
| Molecular Mass | 318.1103 |
|---|
| SMILES | COc1ccc(C(C)C(=O)c2c(O)cc(O)cc2O)cc1OC |
|---|
| InChI Key | LTCJVRJYYVLHCA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | alpha-methyldeoxybenzoin flavonoids |
|---|
| Subclass | alpha-methyldeoxybenzoin flavonoids |
|---|
| Direct Parent | alpha-methyldeoxybenzoin flavonoids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsacylphloroglucinols and derivativesalkyl aryl ethersalkyl-phenylketonesanisolesaryl alkyl ketonesbenzoyl derivativesdimethoxybenzeneshydrocarbon derivativesorganic oxidesphenoxy compoundsphenylpropanesstilbenesvinylogous acids |
|---|
| Substituents | phenol ethermonocyclic benzene moietyetheraryl alkyl ketonebenzoyl1-hydroxy-2-unsubstituted benzenoidalkyl aryl etherketonephenylpropanephloroglucinol derivativedimethoxybenzeneorganic oxideo-dimethoxybenzeneacylphloroglucinol derivativebenzenetriol1-hydroxy-4-unsubstituted benzenoidmethoxybenzenephenylketonealpha-methyldeoxybenzoin flavonoidaromatic homomonocyclic compoundvinylogous acidorganic oxygen compoundanisolephenolhydrocarbon derivativebenzenoidphenoxy compoundalkyl-phenylketoneorganooxygen compoundaryl ketonestilbene |
|---|