Record Information |
---|
HMDB Status | quantified |
---|
Creation Date | 2024-02-20 23:46:39 UTC |
---|
Update Date | 2025-03-21 18:01:01 UTC |
---|
HMDB ID | HMDB0000572 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00030489 |
---|
Name | Desmosine |
---|
Frequency | 122.0 |
---|
Structure | |
---|
Chemical Formula | C24H40N5O8+ |
---|
Molecular Mass | 526.2871 |
---|
SMILES | NC(CCCC[n+]1cc(CCC(N)C(=O)O)c(CCCC(N)C(=O)O)c(CCC(N)C(=O)O)c1)C(=O)O |
---|
InChI Key | VEVRNHHLCPGNDU-UHFFFAOYSA-O |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic acids and derivatives |
---|
Class | carboxylic acids and derivatives |
---|
Subclass | tetracarboxylic acids and derivatives |
---|
Direct Parent | tetracarboxylic acids and derivatives |
---|
Geometric Descriptor | aromatic heteromonocyclic compounds |
---|
Alternative Parents | alpha amino acidsazacyclic compoundscarbonyl compoundscarboxylic acidsheteroaromatic compoundshydrocarbon derivativeshydroxypyridinesmonoalkylaminesorganic cationsorganic oxidesorganonitrogen compoundsorganopnictogen compoundspolyhalopyridines |
---|
Substituents | carbonyl groupcarboxylic acidaromatic heteromonocyclic compoundazacyclepolyhalopyridineheteroaromatic compoundhydroxypyridinetetracarboxylic acid or derivativesalpha-amino acid or derivativesorganic oxidepyridineorganic oxygen compoundorganonitrogen compoundalpha-amino acidorganopnictogen compoundhydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundorganic cationorganoheterocyclic compoundorganooxygen compound |
---|