| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:46:47 UTC |
|---|
| Update Date | 2025-03-21 18:01:04 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00030813 |
|---|
| Frequency | 120.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H6O5 |
|---|
| Molecular Mass | 182.0215 |
|---|
| SMILES | O=C1C=CC(C(O)C(=O)O)=CC1=O |
|---|
| InChI Key | FCZMESQKVZUHRT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbonyl compounds |
|---|
| Direct Parent | quinones |
|---|
| Geometric Descriptor | aliphatic homomonocyclic compounds |
|---|
| Alternative Parents | alpha hydroxy acids and derivativescarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativeso-benzoquinonesorganic oxidessecondary alcohols |
|---|
| Substituents | alcoholcarboxylic acido-benzoquinonealpha-hydroxy acidhydroxy acidcarboxylic acid derivativeorganic oxidemonocarboxylic acid or derivativessecondary alcoholaliphatic homomonocyclic compoundhydrocarbon derivativequinone |
|---|