| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-20 23:46:47 UTC |
|---|
| Update Date | 2025-03-21 18:01:04 UTC |
|---|
| HMDB ID | HMDB0255798 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00030818 |
|---|
| Name | 6-Thioinosine |
|---|
| Frequency | 157.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H12N4O4S |
|---|
| Molecular Mass | 284.0579 |
|---|
| SMILES | OCC1OC(n2cnc3c(S)ncnc32)C(O)C1O |
|---|
| InChI Key | NKGPJODWTZCHGF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | purine nucleosides |
|---|
| Subclass | purine nucleosides |
|---|
| Direct Parent | purine nucleosides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidazolesmonosaccharidesn-substituted imidazolesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsprimary alcoholspurines and purine derivativespyrimidines and pyrimidine derivativessecondary alcoholstetrahydrofuransthiols |
|---|
| Substituents | monosaccharideimidazopyrimidineorganosulfur compoundpyrimidinesaccharidearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundprimary alcoholorganoheterocyclic compoundazolen-substituted imidazolealcoholazacycletetrahydrofuranpurine nucleosideheteroaromatic compoundarylthioloxacycleorganic oxygen compoundsecondary alcoholhydrocarbon derivativepurineorganic nitrogen compoundorganooxygen compound |
|---|
