| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:46:49 UTC |
|---|
| Update Date | 2025-03-21 18:01:05 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00030896 |
|---|
| Frequency | 120.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H12N2O3 |
|---|
| Molecular Mass | 220.0848 |
|---|
| SMILES | CC(=O)NC(=O)CC(=O)c1ccccc1N |
|---|
| InChI Key | KVZZZOUCKKNCEH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbonyl compounds |
|---|
| Direct Parent | alkyl-phenylketones |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | acetamidesamino acids and derivativesaryl alkyl ketonesbenzoyl derivativescarboxylic acids and derivativesdicarboximideshydrocarbon derivativesn-unsubstituted carboxylic acid imidesorganic oxidesorganopnictogen compoundsprimary aminesvinylogous amides |
|---|
| Substituents | monocyclic benzene moietyaryl alkyl ketoneamino acid or derivativesbenzoylcarboxylic acid derivativecarboxylic acid imide, n-unsubstitutedorganic oxideorganonitrogen compoundorganopnictogen compounddicarboximideacetamidevinylogous amidecarboxylic acid imidearomatic homomonocyclic compoundhydrocarbon derivativebenzenoidprimary amineorganic nitrogen compoundaminealkyl-phenylketone |
|---|