Record Information |
---|
HMDB Status | predicted |
---|
Creation Date | 2024-02-20 23:46:52 UTC |
---|
Update Date | 2025-03-21 18:01:06 UTC |
---|
HMDB ID | HMDB0130510 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00031035 |
---|
Name | 7,8-dihydroxy-3-phenyl-4H-chromen-4-one |
---|
Frequency | 119.2 |
---|
Structure | |
---|
Chemical Formula | C15H10O4 |
---|
Molecular Mass | 254.0579 |
---|
SMILES | O=c1c(-c2ccccc2)coc2c(O)c(O)ccc12 |
---|
InChI Key | HNPAPWSBQJTTPD-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | phenylpropanoids and polyketides |
---|
Class | isoflavonoids |
---|
Subclass | isoflav-2-enes |
---|
Direct Parent | isoflavones |
---|
Geometric Descriptor | aromatic heteropolycyclic compounds |
---|
Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsbenzene and substituted derivativeschromonesheteroaromatic compoundshydrocarbon derivativesisoflavonoidsorganic oxidesorganooxygen compoundsoxacyclic compoundspyranones and derivatives |
---|
Substituents | isoflavonemonocyclic benzene moietybenzopyran1-benzopyranheteroaromatic compound1-hydroxy-2-unsubstituted benzenoid1-hydroxy-4-unsubstituted benzenoidoxacycleorganic oxideorganic oxygen compoundchromonearomatic heteropolycyclic compoundpyranpyranonehydrocarbon derivativebenzenoidorganoheterocyclic compoundorganooxygen compound |
---|