| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:46:54 UTC |
|---|
| Update Date | 2025-03-21 18:01:07 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00031096 |
|---|
| Frequency | 118.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C3H9NO8P2 |
|---|
| Molecular Mass | 248.9803 |
|---|
| SMILES | NC(CP(=O)(O)OP(=O)(O)O)C(=O)O |
|---|
| InChI Key | WXCQAPADGBRNDV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alpha amino acids |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acidshydrocarbon derivativesmonoalkylaminesmonocarboxylic acids and derivativesorganic oxidesorganic phosphonic acids and derivativesorganic phosphoric acids and derivativesorganonitrogen compoundsorganophosphorus compoundsorganopnictogen compounds |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupcarboxylic acidorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundorganonitrogen compoundalpha-amino acidorganopnictogen compoundorganophosphorus compoundhydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundorganic phosphoric acid derivativeorganophosphonic acid derivativeorganooxygen compound |
|---|
