| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:47:04 UTC |
|---|
| Update Date | 2025-03-21 18:01:11 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00031512 |
|---|
| Frequency | 116.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H11I2NO3 |
|---|
| Molecular Mass | 494.8828 |
|---|
| SMILES | NC(=O)Cc1cc(I)c(Oc2ccc(O)cc2)c(I)c1 |
|---|
| InChI Key | MQEDLAZWUQORIM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylethers |
|---|
| Direct Parent | diphenylethers |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsaryl iodidescarbonyl compoundscarboxylic acids and derivativesdiarylethershydrocarbon derivativesiodobenzenesorganic oxidesorganoiodidesorganonitrogen compoundsorganopnictogen compoundsphenol ethersphenoxy compoundsphenylacetamidesprimary carboxylic acid amides |
|---|
| Substituents | primary carboxylic acid amidediaryl etherphenol ethercarbonyl groupether1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativeorganohalogen compoundiodobenzeneorganoiodideorganic oxideorganonitrogen compoundorganopnictogen compoundphenylacetamidecarboxamide grouparyl halidearomatic homomonocyclic compoundorganic oxygen compoundphenolhydrocarbon derivativearyl iodideorganic nitrogen compoundhalobenzenephenoxy compounddiphenyletherorganooxygen compound |
|---|