| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:47:06 UTC |
|---|
| Update Date | 2025-03-21 18:01:13 UTC |
|---|
| HMDB ID | HMDB0032583 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00031595 |
|---|
| Name | 4'-Hydroxy-2-biphenylcarboxylic acid |
|---|
| Frequency | 116.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H10O3 |
|---|
| Molecular Mass | 214.063 |
|---|
| SMILES | O=C(O)c1ccccc1-c1ccc(O)cc1 |
|---|
| InChI Key | WJRHSYCQNCDYMN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | benzoic acids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-carboxy-2-haloaromatic compounds1-hydroxy-2-unsubstituted benzenoidsbenzoyl derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganooxygen compounds |
|---|
| Substituents | carboxylic acidbenzoyl1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativearomatic homomonocyclic compoundorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundphenolhydrocarbon derivative1-carboxy-2-haloaromatic compoundbenzoic acidorganooxygen compound |
|---|
