Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-20 23:47:06 UTC |
---|
Update Date | 2025-03-21 18:01:12 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00031599 |
---|
Frequency | 116.4 |
---|
Structure | |
---|
Chemical Formula | C14H18N2O5 |
---|
Molecular Mass | 294.1216 |
---|
SMILES | CN(C)c1ccc(C(=O)NC(CCC(=O)O)C(=O)O)cc1 |
---|
InChI Key | PONGCTQHPDBBIR-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic acids and derivatives |
---|
Class | carboxylic acids and derivatives |
---|
Subclass | amino acids, peptides, and analogues |
---|
Direct Parent | glutamic acid and derivatives |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | alpha amino acidsamino acidsaminobenzamidesaniline and substituted anilinesbenzoyl derivativescarbonyl compoundscarboxylic acidsdialkylarylaminesdicarboxylic acids and derivativeshippuric acids and derivativeshydrocarbon derivativesn-acyl-alpha amino acidsorganic oxidesorganopnictogen compoundssecondary carboxylic acid amides |
---|
Substituents | monocyclic benzene moietycarbonyl groupcarboxylic acidamino acidbenzoylbenzamideorganic oxidetertiary aliphatic/aromatic amineorganonitrogen compoundalpha-amino acidorganopnictogen compounddialkylarylamineaminobenzoic acid or derivativestertiary aminen-acyl-alpha amino acid or derivativesn-acyl-alpha-amino acidhippuric acid or derivativesaniline or substituted anilinesbenzoic acid or derivativesglutamic acid or derivativescarboxamide groupaminobenzamidearomatic homomonocyclic compoundsecondary carboxylic acid amideorganic oxygen compounddicarboxylic acid or derivativeshydrocarbon derivativebenzenoidorganic nitrogen compoundamineorganooxygen compound |
---|