| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:47:07 UTC |
|---|
| Update Date | 2025-03-21 18:01:13 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00031621 |
|---|
| Frequency | 116.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H9NO4S |
|---|
| Molecular Mass | 227.0252 |
|---|
| SMILES | COS(=O)(=O)Oc1cccc2cc[nH]c12 |
|---|
| InChI Key | VDMYBNYBLSNAKQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfuric acids and derivatives |
|---|
| Subclass | arylsulfates |
|---|
| Direct Parent | arylsulfates |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alkyl sulfatesazacyclic compoundsbenzenoidsheteroaromatic compoundshydrocarbon derivativesindolesorganic oxidesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundspyrrolessulfuric acid diesters |
|---|
| Substituents | azacycleindoleheteroaromatic compoundindole or derivativesorganic oxideorganic oxygen compoundsulfuric acid diesteraromatic heteropolycyclic compoundalkyl sulfatepyrroleorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativearylsulfatebenzenoidorganic nitrogen compoundsulfuric acid esterorganoheterocyclic compoundorganooxygen compound |
|---|