| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:47:10 UTC |
|---|
| Update Date | 2025-03-21 18:01:14 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00031738 |
|---|
| Frequency | 115.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H10O4S |
|---|
| Molecular Mass | 238.03 |
|---|
| SMILES | COc1ccc2cccc(S(=O)(=O)O)c2c1 |
|---|
| InChI Key | MPIUPCXJVQWNOH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | naphthalenes |
|---|
| Subclass | naphthalene sulfonic acids and derivatives |
|---|
| Direct Parent | 1-naphthalene sulfonic acids and derivatives |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | 1-naphthalene sulfonates1-sulfo,2-unsubstituted aromatic compoundsalkyl aryl ethersanisolesarylsulfonic acids and derivativeshydrocarbon derivativesorganic oxidesorganosulfonic acidssulfonyls |
|---|
| Substituents | phenol etherorganosulfonic acid or derivativesether1-sulfo,2-unsubstituted aromatic compoundorganosulfonic acidaromatic homopolycyclic compoundalkyl aryl etherorganosulfur compound1-naphthalene sulfonic acid or derivatives1-naphthalene sulfonateorganic oxidesulfonylorganic oxygen compoundarylsulfonic acid or derivativesorganic sulfonic acid or derivativesnaphthalene sulfonateanisolehydrocarbon derivativeorganooxygen compound |
|---|