| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:47:12 UTC |
|---|
| Update Date | 2025-03-21 18:01:15 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00031818 |
|---|
| Frequency | 115.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H15NO6S |
|---|
| Molecular Mass | 313.062 |
|---|
| SMILES | O=C(O)c1ccc(S(=O)(=O)N2CCC(C(=O)O)CC2)cc1 |
|---|
| InChI Key | DTZKAZUPJHYGKX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzenesulfonamides |
|---|
| Direct Parent | benzenesulfonamides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsbenzenesulfonyl compoundsbenzoic acidsbenzoyl derivativescarbonyl compoundscarboxylic acidsdicarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsorganosulfonamidespiperidinecarboxylic acidspiperidinessulfonyls |
|---|
| Substituents | organosulfonic acid or derivativescarbonyl groupcarboxylic acidaromatic heteromonocyclic compoundbenzoylorganosulfur compoundcarboxylic acid derivativeorganosulfonic acid amideorganic oxideorganonitrogen compoundorganopnictogen compoundpiperidinecarboxylic acidbenzoic acidpiperidineorganoheterocyclic compoundbenzenesulfonyl groupbenzenesulfonamideazacyclebenzoic acid or derivativessulfonylorganic oxygen compoundorganic sulfonic acid or derivativesdicarboxylic acid or derivativeshydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|