| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:47:20 UTC |
|---|
| Update Date | 2025-03-21 18:01:18 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00032140 |
|---|
| Frequency | 113.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H16NO2+ |
|---|
| Molecular Mass | 194.1176 |
|---|
| SMILES | C[N+](C)(C)Cc1ccc(C(=O)O)cc1 |
|---|
| InChI Key | YAWAFHRHMGYOTG-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | benzoic acids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | aralkylaminesbenzoyl derivativesbenzylaminescarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic cationsorganic oxidesorganic saltsorganooxygen compoundsorganopnictogen compoundsphenylmethylaminestetraalkylammonium salts |
|---|
| Substituents | carboxylic acidbenzoylcarboxylic acid derivativearalkylamineorganic oxideorganonitrogen compoundorganopnictogen compoundorganic cationbenzoic acidorganic salttetraalkylammonium saltquaternary ammonium saltaromatic homomonocyclic compoundmonocarboxylic acid or derivativesphenylmethylamineorganic oxygen compoundbenzylaminehydrocarbon derivativeorganic nitrogen compoundamineorganooxygen compound |
|---|