| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:47:24 UTC |
|---|
| Update Date | 2025-03-21 18:01:19 UTC |
|---|
| HMDB ID | HMDB0029097 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00032282 |
|---|
| Name | Tryptophyl-Gamma-glutamate |
|---|
| Frequency | 113.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H20N4O4 |
|---|
| Molecular Mass | 332.1485 |
|---|
| SMILES | NC(CCC(=O)NC(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)O |
|---|
| InChI Key | FNGTUNXVLUYBPN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | glutamine and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alpha amino acid amidesalpha amino acidsazacyclic compoundsbenzenoidscarbonyl compoundscarboxylic acidsdicarboximidesheteroaromatic compoundshydrocarbon derivativesindolesmonoalkylaminesmonocarboxylic acids and derivativesn-acyl aminesn-unsubstituted carboxylic acid imidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundspyrroles |
|---|
| Substituents | carbonyl groupcarboxylic acidglutamine or derivativesindolecarboxylic acid imide, n-unsubstitutedorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundalpha-amino acidorganopnictogen compounddicarboximideorganoheterocyclic compoundalpha-amino acid amideazacycleheteroaromatic compoundindole or derivativesn-acyl-aminecarboxylic acid imidemonocarboxylic acid or derivativesorganic oxygen compoundpyrrolehydrocarbon derivativebenzenoidprimary aliphatic amineorganic nitrogen compoundorganooxygen compound |
|---|