| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:47:24 UTC |
|---|
| Update Date | 2025-03-21 18:01:20 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00032301 |
|---|
| Frequency | 113.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C28H35N3O4S |
|---|
| Molecular Mass | 509.2348 |
|---|
| SMILES | CC(C)CN(CC(O)C(Cc1ccccc1)NC(=O)Cc1ccccc1)S(=O)(=O)c1ccc(N)cc1 |
|---|
| InChI Key | IIFXKEHSWHTSGI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | phenylbutylamines |
|---|
| Direct Parent | phenylbutylamines |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | amino acids and derivativesaminosulfonyl compoundsamphetamines and derivativesbenzenesulfonamidesbenzenesulfonyl compoundscarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesorganopnictogen compoundsorganosulfonamidesphenylacetamidesprimary aminessecondary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | organosulfonic acid or derivativescarbonyl groupamino acid or derivativesorganosulfur compoundcarboxylic acid derivativeorganosulfonic acid amideorganic oxidephenylbutylamineorganonitrogen compoundorganopnictogen compoundphenylacetamideamphetamine or derivativesbenzenesulfonyl groupalcoholbenzenesulfonamideaminosulfonyl compoundcarboxamide grouparomatic homomonocyclic compoundsecondary carboxylic acid amidesulfonylorganic oxygen compoundorganic sulfonic acid or derivativessecondary alcoholhydrocarbon derivativeprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|