| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-20 23:47:25 UTC |
|---|
| Update Date | 2025-03-21 18:01:20 UTC |
|---|
| HMDB ID | HMDB0251638 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00032350 |
|---|
| Name | 2'-Deoxy-5'-O-thiophosphonouridine |
|---|
| Frequency | 192.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H13N2O7PS |
|---|
| Molecular Mass | 324.0181 |
|---|
| SMILES | O=c1ccn(C2CC(O)C(COP(O)(O)=S)O2)c(=O)[nH]1 |
|---|
| InChI Key | LGZBLTPUGKWVDT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | pyrimidine nucleosides |
|---|
| Subclass | pyrimidine nucleosides |
|---|
| Direct Parent | pyrimidine nucleosides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativeslactamsmonosaccharidesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundspyrimidonessecondary alcoholstetrahydrofuransthiophosphate monoestersvinylogous amides |
|---|
| Substituents | lactamaromatic heteromonocyclic compoundthiophosphoric acid estermonosaccharidepyrimidonethiophosphate monoesterpyrimidineorganic thiophosphoric acid or derivativessaccharideorganic oxideorganonitrogen compoundorganopnictogen compoundpyrimidine nucleosideorganoheterocyclic compoundalcoholvinylogous amidecarbonic acid derivativeazacycletetrahydrofuranheteroaromatic compoundoxacycleorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
