| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:47:27 UTC |
|---|
| Update Date | 2025-03-21 18:01:21 UTC |
|---|
| HMDB ID | HMDB0002263 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00032426 |
|---|
| Name | Primapterin |
|---|
| Frequency | 176.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H11N5O3 |
|---|
| Molecular Mass | 237.0862 |
|---|
| SMILES | CC(O)C(O)c1cnc2c(=O)[nH]c(N)nc2n1 |
|---|
| InChI Key | LNXRKRFGNHXANN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pterins and derivatives |
|---|
| Direct Parent | pterins and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2-diolsaromatic alcoholsazacyclic compoundsheteroaromatic compoundshydrocarbon derivativeslactamsorganic oxidesorganopnictogen compoundsprimary aminespyrazinespyrimidonessecondary alcohols |
|---|
| Substituents | aromatic alcoholalcoholpterinlactamazacycleheteroaromatic compoundpyrimidonepyrimidineorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundpyrazineorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeprimary amineorganic nitrogen compoundamineorganooxygen compound1,2-diol |
|---|
