| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:47:29 UTC |
|---|
| Update Date | 2025-03-21 18:01:22 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00032505 |
|---|
| Frequency | 112.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H14N2O4 |
|---|
| Molecular Mass | 262.0954 |
|---|
| SMILES | O=C(O)C(O)N=C(O)CCc1c[nH]c2ccccc12 |
|---|
| InChI Key | IDKWTIGSXHHYQL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alpha amino acids |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alkanolaminesalpha hydroxy acids and derivativesazacyclic compoundsbenzenoidscarbonyl compoundscarboximidic acidscarboxylic acidsheteroaromatic compoundshydrocarbon derivativesindolesmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundspropargyl-type 1,3-dipolar organic compoundspyrroles |
|---|
| Substituents | carboximidic acidcarbonyl groupcarboxylic acidindolealpha-hydroxy acidpropargyl-type 1,3-dipolar organic compoundorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundalpha-amino acidorganopnictogen compoundorganoheterocyclic compoundalkanolamineazacycleheteroaromatic compoundindole or derivativesorganic 1,3-dipolar compoundhydroxy acidmonocarboxylic acid or derivativesorganic oxygen compoundpyrrolehydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compound |
|---|