Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-20 23:47:30 UTC |
---|
Update Date | 2025-03-21 18:01:22 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00032535 |
---|
Frequency | 112.2 |
---|
Structure | |
---|
Chemical Formula | C9H7NO6S |
---|
Molecular Mass | 256.9994 |
---|
SMILES | O=C(OS(=O)(=O)O)c1c[nH]c2cc(O)ccc12 |
---|
InChI Key | OXDFDZKOQUPVLE-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organoheterocyclic compounds |
---|
Class | indoles and derivatives |
---|
Subclass | indolecarboxylic acids and derivatives |
---|
Direct Parent | indolecarboxylic acids and derivatives |
---|
Geometric Descriptor | aromatic heteropolycyclic compounds |
---|
Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsazacyclic compoundsbenzenoidsheteroaromatic compoundshydrocarbon derivativesindolesmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundspyrrole carboxylic acids and derivativessulfuric acid monoestersvinylogous amides |
---|
Substituents | sulfuric acid monoesterpyrrole-3-carboxylic acid or derivativesindole1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativeorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundindolecarboxylic acid derivativevinylogous amideorganic sulfuric acid or derivativesazacycleheteroaromatic compoundmonocarboxylic acid or derivativesorganic oxygen compoundpyrrolehydrocarbon derivativebenzenoidorganic nitrogen compoundsulfuric acid esterorganooxygen compound |
---|