| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:47:31 UTC |
|---|
| Update Date | 2025-03-21 18:01:22 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00032561 |
|---|
| Frequency | 112.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H19N3O4S3 |
|---|
| Molecular Mass | 341.0538 |
|---|
| SMILES | CS(=O)CCCCNC(=S)SCC(NC(N)=O)C(=O)O |
|---|
| InChI Key | XUWMSDABFYJEPY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | n-carbamoyl-alpha amino acids |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alpha amino acidscarbonyl compoundscarboxylic acidscysteine and derivativesdithiocarbamic acid estershydrocarbon derivativesmonocarboxylic acids and derivativesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundssulfenyl compoundssulfinyl compoundssulfoxides |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupcarbonic acid derivativecarboxylic acidsulfenyl compoundn-carbamoyl-alpha-amino acidorganosulfur compounddithiocarbamic acid esterorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundsulfinyl compoundcysteine or derivativesorganonitrogen compoundsulfoxidealpha-amino acidorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
