| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:47:35 UTC |
|---|
| Update Date | 2025-03-21 18:01:24 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00032730 |
|---|
| Frequency | 111.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H18N2O3 |
|---|
| Molecular Mass | 274.1317 |
|---|
| SMILES | OC1C=CC(NCc2c[nH]c3ccccc23)C(O)C1O |
|---|
| InChI Key | JLQXDOFUTBINQZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | indoles and derivatives |
|---|
| Subclass | indoles |
|---|
| Direct Parent | indoles |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsbenzenoidscyclitols and derivativesdialkylaminesheteroaromatic compoundshydrocarbon derivativesorganopnictogen compoundspyrrolessecondary alcohols |
|---|
| Substituents | alcoholsecondary aliphatic amineazacycleindoleheteroaromatic compoundcyclitol or derivativessecondary amineorganic oxygen compoundaromatic heteropolycyclic compoundpyrroleorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compoundamine |
|---|