Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-20 23:47:36 UTC |
---|
Update Date | 2025-03-21 18:01:24 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00032750 |
---|
Frequency | 111.3 |
---|
Structure | |
---|
Chemical Formula | C14H18N2O5 |
---|
Molecular Mass | 294.1216 |
---|
SMILES | CC(=O)NC(CO)C(=O)NC(Cc1ccccc1)C(=O)O |
---|
InChI Key | MGCQYONMKWBSKL-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic acids and derivatives |
---|
Class | carboxylic acids and derivatives |
---|
Subclass | amino acids, peptides, and analogues |
---|
Direct Parent | dipeptides |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | acetamidesalpha amino acid amidesalpha amino acidsamphetamines and derivativesbenzene and substituted derivativescarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesn-acyl-alpha amino acidsorganic oxidesorganonitrogen compoundsorganopnictogen compoundsphenylalanine and derivativesphenylpropanoic acidsprimary alcoholssecondary carboxylic acid amidesserine and derivatives |
---|
Substituents | monocyclic benzene moietycarbonyl groupcarboxylic acid3-phenylpropanoic-acidalpha-amino acid or derivativesorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundprimary alcoholacetamideamphetamine or derivativesn-acyl-alpha amino acid or derivativesalcoholalpha-amino acid amiden-acyl-alpha-amino acidcarboxamide groupn-substituted-alpha-amino acidaromatic homomonocyclic compoundalpha-dipeptidesecondary carboxylic acid amidemonocarboxylic acid or derivativesphenylalanine or derivativesorganic oxygen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundserine or derivativesorganooxygen compound |
---|