| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:47:36 UTC |
|---|
| Update Date | 2025-03-21 18:01:24 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00032751 |
|---|
| Frequency | 111.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H17NO2 |
|---|
| Molecular Mass | 255.1259 |
|---|
| SMILES | NC(Cc1ccccc1)C(=O)OCc1ccccc1 |
|---|
| InChI Key | FPRSPUHXEPWUBZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | phenylalanine and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alpha amino acid estersalpha amino acidsamphetamines and derivativesbenzyloxycarbonylscarbonyl compoundscarboxylic acid estersfatty acid estershydrocarbon derivativesmonoalkylaminesmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compounds |
|---|
| Substituents | benzyloxycarbonylfatty acylmonocyclic benzene moietycarbonyl groupalpha-amino acid esteraromatic homomonocyclic compoundfatty acid esterorganic oxidemonocarboxylic acid or derivativesphenylalanine or derivativesorganic oxygen compoundcarboxylic acid esterorganonitrogen compoundalpha-amino acidorganopnictogen compoundhydrocarbon derivativebenzenoidprimary aliphatic amineorganic nitrogen compoundorganooxygen compoundamphetamine or derivatives |
|---|