| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:47:36 UTC |
|---|
| Update Date | 2025-03-21 18:01:24 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00032752 |
|---|
| Frequency | 111.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H9NO |
|---|
| Molecular Mass | 183.0684 |
|---|
| SMILES | Oc1ccc2c(ccc3[nH]ccc32)c1 |
|---|
| InChI Key | MYTUZGNNXVYREH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | naphthalenes |
|---|
| Subclass | naphthols and derivatives |
|---|
| Direct Parent | naphthols and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsazacyclic compoundsheteroaromatic compoundshydrocarbon derivativesindolesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundspyrroles |
|---|
| Substituents | azacycleindoleheteroaromatic compound1-hydroxy-2-unsubstituted benzenoidindole or derivativesorganic oxygen compoundaromatic heteropolycyclic compoundpyrroleorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compound2-naphtholorganoheterocyclic compoundorganooxygen compound |
|---|