| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:47:37 UTC |
|---|
| Update Date | 2025-03-21 18:01:25 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00032802 |
|---|
| Frequency | 111.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H8O4S |
|---|
| Molecular Mass | 224.0143 |
|---|
| SMILES | O=S(=O)(O)c1ccc(O)c2ccccc12 |
|---|
| InChI Key | HGWQOFDAUWCQDA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | naphthalenes |
|---|
| Subclass | naphthalene sulfonic acids and derivatives |
|---|
| Direct Parent | 1-naphthalene sulfonic acids and derivatives |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-naphthalene sulfonates1-sulfo,2-unsubstituted aromatic compoundsarylsulfonic acids and derivativeshydrocarbon derivativesnaphthols and derivativesorganic oxidesorganooxygen compoundsorganosulfonic acidssulfonyls |
|---|
| Substituents | organosulfonic acid or derivatives1-sulfo,2-unsubstituted aromatic compoundorganosulfonic acid1-hydroxy-2-unsubstituted benzenoidaromatic homopolycyclic compoundorganosulfur compound1-naphthalene sulfonic acid or derivatives1-naphthalene sulfonateorganic oxidesulfonylarylsulfonic acid or derivativesorganic oxygen compoundorganic sulfonic acid or derivativesnaphthalene sulfonatehydrocarbon derivative1-naphtholorganooxygen compound |
|---|