| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:47:39 UTC |
|---|
| Update Date | 2025-03-21 18:01:26 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00032889 |
|---|
| Frequency | 110.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H23N6O10P |
|---|
| Molecular Mass | 478.1213 |
|---|
| SMILES | CC(=O)NC1C(O)C(O)C(n2cnc3c(N)ncnc32)OC1C(O)C(O)COP(=O)(O)O |
|---|
| InChI Key | ZFEQJDLPVOZNBA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | imidazopyrimidines |
|---|
| Subclass | purines and purine derivatives |
|---|
| Direct Parent | purines and purine derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | acetamidesamino acids and derivativesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativesheteroaromatic compoundshydrocarbon derivativesimidazolesimidolactamsmonoalkyl phosphatesmonosaccharidesn-substituted imidazolesorganic oxidesorganopnictogen compoundsoxacyclic compoundsoxanesprimary aminespyrimidines and pyrimidine derivativessecondary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | carbonyl groupamino acid or derivativesmonosaccharidecarboxylic acid derivativepyrimidinesaccharideorganic oxidearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundoxaneimidolactamacetamideazolen-substituted imidazolealcoholazacycleheteroaromatic compoundcarboxamide groupoxacyclesecondary carboxylic acid amideorganic oxygen compoundphosphoric acid estermonoalkyl phosphatesecondary alcoholhydrocarbon derivativeprimary aminepurineorganic nitrogen compoundorganic phosphoric acid derivativeaminealkyl phosphateorganooxygen compound |
|---|