| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:47:40 UTC |
|---|
| Update Date | 2025-03-21 18:01:27 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00032942 |
|---|
| Frequency | 110.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H12N2O4 |
|---|
| Molecular Mass | 236.0797 |
|---|
| SMILES | CC(=O)Nc1cccc(C(=O)NCC(=O)O)c1 |
|---|
| InChI Key | FYGAEZGIIJNAIB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | acyl glycines |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | acetamidesacetanilidesacylaminobenzoic acid and derivativesalpha amino acidsbenzoyl derivativescarbonyl compoundscarboxylic acidshippuric acids and derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesn-acetylarylaminesorganic oxidesorganopnictogen compoundssecondary carboxylic acid amides |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupcarboxylic acidn-acetylarylaminebenzoyln-arylamidebenzamideorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundacetamideacylaminobenzoic acid or derivativesacetanilidehippuric acid or derivativesbenzoic acid or derivativescarboxamide groupn-acylglycinearomatic homomonocyclic compoundanilidesecondary carboxylic acid amidemonocarboxylic acid or derivativesorganic oxygen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compound |
|---|