| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:47:42 UTC |
|---|
| Update Date | 2025-03-21 18:01:27 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00033000 |
|---|
| Frequency | 110.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H8N3O6P |
|---|
| Molecular Mass | 261.0151 |
|---|
| SMILES | Nc1ccn(C2OC3OP(=O)(O)OC32)c(=O)n1 |
|---|
| InChI Key | PHUADGUHDMAZJB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazines |
|---|
| Subclass | pyrimidines and pyrimidine derivatives |
|---|
| Direct Parent | pyrimidones |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsdioxaphospholanesheteroaromatic compoundshydrocarbon derivativesimidolactamsorganic carbonic acids and derivativesorganic oxidesorganic phosphoric acids and derivativesorganooxygen compoundsorganopnictogen compoundsoxacyclic compoundsoxetanesprimary amines |
|---|
| Substituents | carbonic acid derivativeazacycleheteroaromatic compoundpyrimidone1,3_dioxaphospholaneoxacycleorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundoxetaneorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeprimary amineorganic nitrogen compoundimidolactamorganic phosphoric acid derivativeamineorganooxygen compound |
|---|
