| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:47:46 UTC |
|---|
| Update Date | 2025-03-21 18:01:30 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00033186 |
|---|
| Frequency | 109.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H19NO10 |
|---|
| Molecular Mass | 325.1009 |
|---|
| SMILES | CC(=O)NC1C(O)CC(O)(C(=O)O)OOC1C(O)C(O)CO |
|---|
| InChI Key | QBDROOBKPHOCSN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | dioxepanes |
|---|
| Subclass | 1,2-dioxepanes |
|---|
| Direct Parent | 1,2-dioxepanes |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetamidesalpha hydroxy acids and derivativescarbonyl compoundscarboxylic acidsdialkyl peroxideshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsprimary alcoholssecondary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | carbonyl groupcarboxylic acidalpha-hydroxy acidcarboxylic acid derivativeorganic oxidedialkyl peroxidealiphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundprimary alcoholacetamidealcoholhydroxy acidcarboxamide group1,2-dioxepaneoxacyclesecondary carboxylic acid amidemonocarboxylic acid or derivativesorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
