| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:47:48 UTC |
|---|
| Update Date | 2025-03-21 18:01:30 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00033252 |
|---|
| Frequency | 109.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H10N6O4 |
|---|
| Molecular Mass | 266.0764 |
|---|
| SMILES | Nc1nc(=O)c2c([nH]1)NCC(C(=O)C(N)C(=O)O)=N2 |
|---|
| InChI Key | IQFFVCVLHNVITJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pterins and derivatives |
|---|
| Direct Parent | pterins and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,3-dicarbonyl compoundsalpha amino acidsamino acidsazacyclic compoundsbeta-hydroxy ketonesbeta-keto acids and derivativescarboxylic acidsheteroaromatic compoundshydrocarbon derivativesketiminesmonoalkylaminesmonocarboxylic acids and derivativesorganic oxidesorganopnictogen compoundspropargyl-type 1,3-dipolar organic compoundspyrimidonessecondary alkylarylaminesvinylogous amides |
|---|
| Substituents | beta-hydroxy ketoneketiminecarbonyl groupcarboxylic acidamino acid or derivativesamino acidiminepyrimidonealpha-amino acid or derivativescarboxylic acid derivativebeta-keto acidpyrimidinepropargyl-type 1,3-dipolar organic compoundketoneorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundalpha-amino acidorganopnictogen compoundvinylogous amidepterinazacycleheteroaromatic compoundorganic 1,3-dipolar compoundsecondary aminesecondary aliphatic/aromatic aminemonocarboxylic acid or derivativesorganic oxygen compoundketo acidhydrocarbon derivativeprimary aliphatic amineprimary amineorganic nitrogen compound1,3-dicarbonyl compoundamineorganooxygen compound |
|---|