DeepMet

Record Information
HMDB Status	Not Available
Creation Date	2024-02-20 23:47:48 UTC
Update Date	2025-03-21 18:01:30 UTC
HMDB ID	Not Available
Metabolite Identification
DeepMet ID	DMID00033266
Frequency	109.2
Structure
Chemical Formula	C₁₆H₁₆N₂O₃
Molecular Mass	284.1161
SMILES	Nc1ccccc1C(=O)NC(Cc1ccccc1)C(=O)O
InChI Key	CDGIMWSYQRLCDM-UHFFFAOYSA-N
Chemical Taxonomy
Kingdom	organic compounds
Superclass	organic acids and derivatives
Class	carboxylic acids and derivatives
Subclass	amino acids, peptides, and analogues
Direct Parent	phenylalanine and derivatives
Geometric Descriptor	aromatic homomonocyclic compounds
Alternative Parents	alpha amino acids amino acids amphetamines and derivatives benzoyl derivatives carbonyl compounds carboxylic acids hippuric acids and derivatives hydrocarbon derivatives monocarboxylic acids and derivatives n-acyl-alpha amino acids organic oxides organopnictogen compounds phenylpropanoic acids primary amines secondary carboxylic acid amides vinylogous amides
Substituents	monocyclic benzene moiety carbonyl group carboxylic acid 3-phenylpropanoic-acid amino acid benzoyl benzamide organic oxide organonitrogen compound alpha-amino acid organopnictogen compound amphetamine or derivatives n-acyl-alpha amino acid or derivatives vinylogous amide n-acyl-alpha-amino acid hippuric acid or derivatives benzoic acid or derivatives carboxamide group aromatic homomonocyclic compound secondary carboxylic acid amide monocarboxylic acid or derivatives phenylalanine or derivatives organic oxygen compound hydrocarbon derivative benzenoid primary amine organic nitrogen compound amine organooxygen compound

Showing information for DMID00033266