| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:47:51 UTC |
|---|
| Update Date | 2025-03-21 18:01:32 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00033380 |
|---|
| Frequency | 108.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H17NO3 |
|---|
| Molecular Mass | 247.1208 |
|---|
| SMILES | O=C(O)C1CCN(C(=O)Cc2ccccc2)CC1 |
|---|
| InChI Key | OTVPLNPLEZXHGE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | phenylacetamides |
|---|
| Direct Parent | phenylacetamides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundscarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesn-acylpiperidinesorganic oxidesorganonitrogen compoundsorganopnictogen compoundspiperidinecarboxylic acidstertiary carboxylic acid amides |
|---|
| Substituents | carbonyl groupcarboxylic acidaromatic heteromonocyclic compoundazacyclecarboxamide groupcarboxylic acid derivativen-acyl-piperidineorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundtertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativepiperidinecarboxylic acidorganic nitrogen compoundpiperidinephenylacetamideorganoheterocyclic compoundorganooxygen compound |
|---|
