Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-20 23:47:55 UTC |
---|
Update Date | 2025-03-21 18:01:34 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00033526 |
---|
Frequency | 145.5 |
---|
Structure | |
---|
Chemical Formula | C9H9NO7S |
---|
Molecular Mass | 275.01 |
---|
SMILES | O=C(O)CNC(=O)c1cccc(OS(=O)(=O)O)c1 |
---|
InChI Key | SBLCKJXUMHOIBU-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic acids and derivatives |
---|
Class | carboxylic acids and derivatives |
---|
Subclass | amino acids, peptides, and analogues |
---|
Direct Parent | acyl glycines |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | alpha amino acidsbenzoyl derivativescarbonyl compoundscarboxylic acidshippuric acids and derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsphenoxy compoundsphenylsulfatessecondary carboxylic acid amidessulfuric acid monoesters |
---|
Substituents | monocyclic benzene moietysulfuric acid monoestercarbonyl groupcarboxylic acidbenzoylbenzamidephenylsulfateorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundarylsulfateorganic sulfuric acid or derivativeshippuric acid or derivativesbenzoic acid or derivativescarboxamide groupn-acylglycinearomatic homomonocyclic compoundsecondary carboxylic acid amidemonocarboxylic acid or derivativesorganic oxygen compoundsulfate-esterhydrocarbon derivativebenzenoidorganic nitrogen compoundphenoxy compoundsulfuric acid esterorganooxygen compound |
---|