| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:47:56 UTC |
|---|
| Update Date | 2025-03-21 18:01:34 UTC |
|---|
| HMDB ID | HMDB0240258 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00033585 |
|---|
| Name | Succinylacetoacetate |
|---|
| Frequency | 107.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H10O6 |
|---|
| Molecular Mass | 202.0477 |
|---|
| SMILES | O=C(O)CCC(=O)CC(=O)CC(=O)O |
|---|
| InChI Key | OMFWHSRZHVVVAL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | keto acids and derivatives |
|---|
| Subclass | medium-chain keto acids and derivatives |
|---|
| Direct Parent | medium-chain keto acids and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | beta-hydroxy ketonesbeta-keto acids and derivativescarboxylic acidsdicarboxylic acids and derivativesgamma-keto acids and derivativeshydrocarbon derivativesorganic oxides |
|---|
| Substituents | beta-hydroxy ketonealiphatic acyclic compoundcarbonyl groupcarboxylic acidcarboxylic acid derivativebeta-keto acidgamma-keto acidketoneorganic oxideorganic oxygen compounddicarboxylic acid or derivativeshydrocarbon derivativeorganooxygen compoundmedium-chain keto acid |
|---|
