| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:47:56 UTC |
|---|
| Update Date | 2025-03-21 18:01:35 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00033595 |
|---|
| Frequency | 107.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C5H4O6S |
|---|
| Molecular Mass | 191.9729 |
|---|
| SMILES | O=C(O)c1ccc(S(=O)(=O)O)o1 |
|---|
| InChI Key | GZXIBGIUGORTLA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfonic acids and derivatives |
|---|
| Subclass | organosulfonic acids and derivatives |
|---|
| Direct Parent | arylsulfonic acids and derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | carboxylic acidsfuroic acidsheteroaromatic compoundshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganooxygen compoundsorganosulfonic acidsoxacyclic compoundssulfonyls |
|---|
| Substituents | furanfuroic acid or derivativescarboxylic acidaromatic heteromonocyclic compoundheteroaromatic compoundorganosulfonic acidorganosulfur compoundcarboxylic acid derivativefuroic acidoxacycleorganic oxidemonocarboxylic acid or derivativessulfonylorganic oxygen compoundarylsulfonic acid or derivativeshydrocarbon derivativeorganoheterocyclic compoundorganooxygen compound |
|---|
