| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:47:58 UTC |
|---|
| Update Date | 2025-03-21 18:01:35 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00033644 |
|---|
| Frequency | 107.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C4H7O7P |
|---|
| Molecular Mass | 197.9929 |
|---|
| SMILES | CC(OP(=O)(O)O)C(=O)C(=O)O |
|---|
| InChI Key | NDVBLMGXPPBJQS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbonyl compounds |
|---|
| Direct Parent | glycerone phosphates |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alpha-hydroxy ketonesalpha-keto acids and derivativescarboxylic acidshydrocarbon derivativesmonoalkyl phosphatesmonocarboxylic acids and derivativesorganic oxidesshort-chain keto acids and derivatives |
|---|
| Substituents | aliphatic acyclic compoundcarboxylic acidshort-chain keto acidalpha-hydroxy ketonecarboxylic acid derivativeglycerone phosphateorganic oxidemonocarboxylic acid or derivativesphosphoric acid estermonoalkyl phosphateketo acidalpha-keto acidhydrocarbon derivativeorganic phosphoric acid derivativealkyl phosphate |
|---|
